C43H42N10O — CID 59733823
2-[[4,6-bis[4-[(4,8-dimethylnaphthalen-2-yl)diazenyl]-3-methylanilino]-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 59733823) has the molecular formula C43H42N10O and a molecular weight of 714.88 g/mol. Its IUPAC name is 2-[[4,6-bis[4-[(4,8-dimethylnaphthalen-2-yl)diazenyl]-3-methylanilino]-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 2-[[4,6-bis[4-[(4,8-dimethylnaphthalen-2-yl)diazenyl]-3-methylanilino]-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 59733823 |
| Molecular Formula | C43H42N10O |
| Molecular Weight | 714.88 g/mol |
| Exact Mass | 714.35 |
| IUPAC Name | 2-[[4,6-bis[4-[(4,8-dimethylnaphthalen-2-yl)diazenyl]-3-methylanilino]-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | Cc1cc(Nc2nc(NCCO)nc(Nc3ccc(/N=N/c4cc(C)c5cccc(C)c5c4)c(C)c3)n2)ccc1/N=N/c1cc(C)c2cccc(C)c2c1 |
| InChI | InChI=1S/C43H42N10O/c1-25-9-7-11-35-27(3)19-33(23-37(25)35)50-52-39-15-13-31(21-29(39)5)45-42-47-41(44-17-18-54)48-43(49-42)46-32-14-16-40(30(6)22-32)53-51-34-20-28(4)36-12-8-10-26(2)38(36)24-34/h7-16,19-24,54H,17-18H2,1-6H3,(H3,44,45,46,47,48,49)/b52-50+,53-51+ |
| InChIKey | DZDOSJSHQNMYJN-NMWXCNFPSA-N |
| XLogP | 11.75 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.88 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|