C30H27FN8O — CID 58965470
N-[2-[(4,8-dimethylnaphthalen-2-yl)diazenyl]-5-[[4-fluoro-6-(4-methylanilino)-1,3,5-triazin-2-yl]amino]phenyl]acetamide (PubChem CID 58965470) has the molecular formula C30H27FN8O and a molecular weight of 534.60 g/mol. Its IUPAC name is N-[2-[(4,8-dimethylnaphthalen-2-yl)diazenyl]-5-[[4-fluoro-6-(4-methylanilino)-1,3,5-triazin-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[2-[(4,8-dimethylnaphthalen-2-yl)diazenyl]-5-[[4-fluoro-6-(4-methylanilino)-1,3,5-triazin-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 58965470 |
| Molecular Formula | C30H27FN8O |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | N-[2-[(4,8-dimethylnaphthalen-2-yl)diazenyl]-5-[[4-fluoro-6-(4-methylanilino)-1,3,5-triazin-2-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(Nc2nc(F)nc(Nc3ccc(C)cc3)n2)ccc1/N=N/c1cc(C)c2cccc(C)c2c1 |
| InChI | InChI=1S/C30H27FN8O/c1-17-8-10-21(11-9-17)33-29-35-28(31)36-30(37-29)34-22-12-13-26(27(16-22)32-20(4)40)39-38-23-14-19(3)24-7-5-6-18(2)25(24)15-23/h5-16H,1-4H3,(H,32,40)(H2,33,34,35,36,37)/b39-38+ |
| InChIKey | HTRUOBVKOBBKOQ-YMZYAJTMSA-N |
| XLogP | 7.95 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|