C26H20FN9OS3 — CID 136638929
[2-[[5,7-bis(sulfanyl)naphthalen-2-yl]diazenyl]-5-[[4-fluoro-6-(4-sulfanylanilino)-1,3,5-triazin-2-yl]amino]phenyl]urea (PubChem CID 136638929) has the molecular formula C26H20FN9OS3 and a molecular weight of 589.71 g/mol. Its IUPAC name is [2-[[5,7-bis(sulfanyl)naphthalen-2-yl]diazenyl]-5-[[4-fluoro-6-(4-sulfanylanilino)-1,3,5-triazin-2-yl]amino]phenyl]urea.
| Compound Name | [2-[[5,7-bis(sulfanyl)naphthalen-2-yl]diazenyl]-5-[[4-fluoro-6-(4-sulfanylanilino)-1,3,5-triazin-2-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 136638929 |
| Molecular Formula | C26H20FN9OS3 |
| Molecular Weight | 589.71 g/mol |
| Exact Mass | 589.09 |
| IUPAC Name | [2-[[5,7-bis(sulfanyl)naphthalen-2-yl]diazenyl]-5-[[4-fluoro-6-(4-sulfanylanilino)-1,3,5-triazin-2-yl]amino]phenyl]urea |
| SMILES | NC(=O)Nc1cc(Nc2nc(F)nc(Nc3ccc(S)cc3)n2)ccc1/N=N/c1ccc2c(S)cc(S)cc2c1 |
| InChI | InChI=1S/C26H20FN9OS3/c27-23-32-25(29-14-1-5-17(38)6-2-14)34-26(33-23)30-15-4-8-20(21(11-15)31-24(28)37)36-35-16-3-7-19-13(9-16)10-18(39)12-22(19)40/h1-12,38-40H,(H3,28,31,37)(H2,29,30,32,33,34)/b36-35+ |
| InChIKey | MKGHZKVGWYSYRL-ULDVOPSXSA-N |
| XLogP | 7.42 |
| TPSA | 142.57 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.71 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|