C27H23FN8O3S3 — CID 136633493
2-[4-[[4-[3-[(2-amino-7-sulfanylnaphthalen-1-yl)diazenyl]-4-sulfanylanilino]-6-fluoro-1,3,5-triazin-2-yl]amino]phenyl]sulfonylethanol (PubChem CID 136633493) has the molecular formula C27H23FN8O3S3 and a molecular weight of 622.73 g/mol. Its IUPAC name is 2-[4-[[4-[3-[(2-amino-7-sulfanylnaphthalen-1-yl)diazenyl]-4-sulfanylanilino]-6-fluoro-1,3,5-triazin-2-yl]amino]phenyl]sulfonylethanol.
| Compound Name | 2-[4-[[4-[3-[(2-amino-7-sulfanylnaphthalen-1-yl)diazenyl]-4-sulfanylanilino]-6-fluoro-1,3,5-triazin-2-yl]amino]phenyl]sulfonylethanol |
|---|---|
| PubChem CID | 136633493 |
| Molecular Formula | C27H23FN8O3S3 |
| Molecular Weight | 622.73 g/mol |
| Exact Mass | 622.10 |
| IUPAC Name | 2-[4-[[4-[3-[(2-amino-7-sulfanylnaphthalen-1-yl)diazenyl]-4-sulfanylanilino]-6-fluoro-1,3,5-triazin-2-yl]amino]phenyl]sulfonylethanol |
| SMILES | Nc1ccc2ccc(S)cc2c1/N=N/c1cc(Nc2nc(F)nc(Nc3ccc(S(=O)(=O)CCO)cc3)n2)ccc1S |
| InChI | InChI=1S/C27H23FN8O3S3/c28-25-32-26(30-16-3-7-19(8-4-16)42(38,39)12-11-37)34-27(33-25)31-17-5-10-23(41)22(13-17)35-36-24-20-14-18(40)6-1-15(20)2-9-21(24)29/h1-10,13-14,37,40-41H,11-12,29H2,(H2,30,31,32,33,34)/b36-35+ |
| InChIKey | HZQJLTUFKZBZTN-ULDVOPSXSA-N |
| XLogP | 5.99 |
| TPSA | 167.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.73 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|