C15H17N5O4S — CID 129086311
[3-amino-4-[[4-(2-hydroxyethylsulfonyl)phenyl]diazenyl]phenyl]urea (PubChem CID 129086311) has the molecular formula C15H17N5O4S and a molecular weight of 363.40 g/mol. Its IUPAC name is [3-amino-4-[[4-(2-hydroxyethylsulfonyl)phenyl]diazenyl]phenyl]urea.
| Compound Name | [3-amino-4-[[4-(2-hydroxyethylsulfonyl)phenyl]diazenyl]phenyl]urea |
|---|---|
| PubChem CID | 129086311 |
| Molecular Formula | C15H17N5O4S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | [3-amino-4-[[4-(2-hydroxyethylsulfonyl)phenyl]diazenyl]phenyl]urea |
| SMILES | NC(=O)Nc1ccc(/N=N/c2ccc(S(=O)(=O)CCO)cc2)c(N)c1 |
| InChI | InChI=1S/C15H17N5O4S/c16-13-9-11(18-15(17)22)3-6-14(13)20-19-10-1-4-12(5-2-10)25(23,24)8-7-21/h1-6,9,21H,7-8,16H2,(H3,17,18,22)/b20-19+ |
| InChIKey | ONPCLSVAEDCZQE-FMQUCBEESA-N |
| XLogP | 1.94 |
| TPSA | 160.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|