C18H22N4O10S3 — CID 22886189
methyl 4-acetamido-2-amino-5-[[4-(2-methoxysulfonyloxyethylsulfonyl)phenyl]diazenyl]benzenesulfonate (PubChem CID 22886189) has the molecular formula C18H22N4O10S3 and a molecular weight of 550.59 g/mol. Its IUPAC name is methyl 4-acetamido-2-amino-5-[[4-(2-methoxysulfonyloxyethylsulfonyl)phenyl]diazenyl]benzenesulfonate.
| Compound Name | methyl 4-acetamido-2-amino-5-[[4-(2-methoxysulfonyloxyethylsulfonyl)phenyl]diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 22886189 |
| Molecular Formula | C18H22N4O10S3 |
| Molecular Weight | 550.59 g/mol |
| Exact Mass | 550.05 |
| IUPAC Name | methyl 4-acetamido-2-amino-5-[[4-(2-methoxysulfonyloxyethylsulfonyl)phenyl]diazenyl]benzenesulfonate |
| SMILES | COS(=O)(=O)OCCS(=O)(=O)c1ccc(/N=N/c2cc(S(=O)(=O)OC)c(N)cc2NC(C)=O)cc1 |
| InChI | InChI=1S/C18H22N4O10S3/c1-12(23)20-16-10-15(19)18(34(26,27)30-2)11-17(16)22-21-13-4-6-14(7-5-13)33(24,25)9-8-32-35(28,29)31-3/h4-7,10-11H,8-9,19H2,1-3H3,(H,20,23)/b22-21+ |
| InChIKey | KVZQTSNALXHDBC-QURGRASLSA-N |
| XLogP | 1.66 |
| TPSA | 209.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.59 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|