C17H20N4O8S2 — CID 22976344
4-acetamido-2-amino-5-[[4-(3-sulfooxypropyl)phenyl]diazenyl]benzenesulfonic acid (PubChem CID 22976344) has the molecular formula C17H20N4O8S2 and a molecular weight of 472.50 g/mol. Its IUPAC name is 4-acetamido-2-amino-5-[[4-(3-sulfooxypropyl)phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-acetamido-2-amino-5-[[4-(3-sulfooxypropyl)phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 22976344 |
| Molecular Formula | C17H20N4O8S2 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | 4-acetamido-2-amino-5-[[4-(3-sulfooxypropyl)phenyl]diazenyl]benzenesulfonic acid |
| SMILES | CC(=O)Nc1cc(N)c(S(=O)(=O)O)cc1/N=N/c1ccc(CCCOS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C17H20N4O8S2/c1-11(22)19-15-9-14(18)17(30(23,24)25)10-16(15)21-20-13-6-4-12(5-7-13)3-2-8-29-31(26,27)28/h4-7,9-10H,2-3,8,18H2,1H3,(H,19,22)(H,23,24,25)(H,26,27,28)/b21-20+ |
| InChIKey | BLDMNRDLECEXPT-QZQOTICOSA-N |
| XLogP | 2.64 |
| TPSA | 197.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|