C16H16N4Na2O10S3 — CID 59794906
disodium;4-acetamido-2-amino-5-[[4-(2-oxidoperoxysulfanyloxyethylsulfonyl)phenyl]diazenyl]benzenesulfonate (PubChem CID 59794906) has the molecular formula C16H16N4Na2O10S3 and a molecular weight of 566.50 g/mol. Its IUPAC name is disodium;4-acetamido-2-amino-5-[[4-(2-oxidoperoxysulfanyloxyethylsulfonyl)phenyl]diazenyl]benzenesulfonate.
| Compound Name | disodium;4-acetamido-2-amino-5-[[4-(2-oxidoperoxysulfanyloxyethylsulfonyl)phenyl]diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 59794906 |
| Molecular Formula | C16H16N4Na2O10S3 |
| Molecular Weight | 566.50 g/mol |
| Exact Mass | 565.98 |
| IUPAC Name | disodium;4-acetamido-2-amino-5-[[4-(2-oxidoperoxysulfanyloxyethylsulfonyl)phenyl]diazenyl]benzenesulfonate |
| SMILES | CC(=O)Nc1cc(N)c(S(=O)(=O)[O-])cc1/N=N/c1ccc(S(=O)(=O)CCOSOO[O-])cc1.[Na+].[Na+] |
| InChI | InChI=1S/C16H18N4O10S3.2Na/c1-10(21)18-14-8-13(17)16(33(25,26)27)9-15(14)20-19-11-2-4-12(5-3-11)32(23,24)7-6-28-31-30-29-22;;/h2-5,8-9,22H,6-7,17H2,1H3,(H,18,21)(H,25,26,27);;/q;2*+1/p-2/b20-19+;; |
| InChIKey | GHIGKVTULCMPIU-LLIZZRELSA-L |
| XLogP | -4.87 |
| TPSA | 221.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.50 |
| LogP ≤ 5 | -4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|