C9H10N2Na2O9S3 — CID 59858299
disodium;2-(methyldiazenyl)-5-(2-oxidoperoxysulfanyloxyethylsulfonyl)benzenesulfonate (PubChem CID 59858299) has the molecular formula C9H10N2Na2O9S3 and a molecular weight of 432.37 g/mol. Its IUPAC name is disodium;2-(methyldiazenyl)-5-(2-oxidoperoxysulfanyloxyethylsulfonyl)benzenesulfonate.
| Compound Name | disodium;2-(methyldiazenyl)-5-(2-oxidoperoxysulfanyloxyethylsulfonyl)benzenesulfonate |
|---|---|
| PubChem CID | 59858299 |
| Molecular Formula | C9H10N2Na2O9S3 |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 431.93 |
| IUPAC Name | disodium;2-(methyldiazenyl)-5-(2-oxidoperoxysulfanyloxyethylsulfonyl)benzenesulfonate |
| SMILES | C/N=N/c1ccc(S(=O)(=O)CCOSOO[O-])cc1S(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C9H12N2O9S3.2Na/c1-10-11-8-3-2-7(6-9(8)23(15,16)17)22(13,14)5-4-18-21-20-19-12;;/h2-3,6,12H,4-5H2,1H3,(H,15,16,17);;/q;2*+1/p-2/b11-10+;; |
| InChIKey | CAVHHDWEKMZGEQ-BGNBUWATSA-L |
| XLogP | -6.11 |
| TPSA | 166.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | -6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|