C13H14N4O3S — CID 58820481
2-amino-4-(methylamino)-5-phenyldiazenylbenzenesulfonic acid (PubChem CID 58820481) has the molecular formula C13H14N4O3S and a molecular weight of 306.35 g/mol. Its IUPAC name is 2-amino-4-(methylamino)-5-phenyldiazenylbenzenesulfonic acid.
| Compound Name | 2-amino-4-(methylamino)-5-phenyldiazenylbenzenesulfonic acid |
|---|---|
| PubChem CID | 58820481 |
| Molecular Formula | C13H14N4O3S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-amino-4-(methylamino)-5-phenyldiazenylbenzenesulfonic acid |
| SMILES | CNc1cc(N)c(S(=O)(=O)O)cc1/N=N/c1ccccc1 |
| InChI | InChI=1S/C13H14N4O3S/c1-15-11-7-10(14)13(21(18,19)20)8-12(11)17-16-9-5-3-2-4-6-9/h2-8,15H,14H2,1H3,(H,18,19,20)/b17-16+ |
| InChIKey | VJUXLMOXZZJHMK-WUKNDPDISA-N |
| XLogP | 2.97 |
| TPSA | 117.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|