C23H26N6O15S5 — CID 89366324
2-[[4-amino-2-(methylamino)-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]-5-(2-sulfooxyethylsulfonyl)benzenesulfonic acid (PubChem CID 89366324) has the molecular formula C23H26N6O15S5 and a molecular weight of 786.82 g/mol. Its IUPAC name is 2-[[4-amino-2-(methylamino)-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]-5-(2-sulfooxyethylsulfonyl)benzenesulfonic acid.
| Compound Name | 2-[[4-amino-2-(methylamino)-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]-5-(2-sulfooxyethylsulfonyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 89366324 |
| Molecular Formula | C23H26N6O15S5 |
| Molecular Weight | 786.82 g/mol |
| Exact Mass | 786.01 |
| IUPAC Name | 2-[[4-amino-2-(methylamino)-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]-5-(2-sulfooxyethylsulfonyl)benzenesulfonic acid |
| SMILES | CNc1cc(N)c(/N=N/c2ccc(S(=O)(=O)CCOS(=O)(=O)O)cc2)cc1/N=N/c1ccc(S(=O)(=O)CCOS(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C23H26N6O15S5/c1-25-21-13-18(24)20(28-26-15-2-4-16(5-3-15)45(30,31)10-8-43-48(37,38)39)14-22(21)29-27-19-7-6-17(12-23(19)47(34,35)36)46(32,33)11-9-44-49(40,41)42/h2-7,12-14,25H,8-11,24H2,1H3,(H,34,35,36)(H,37,38,39)(H,40,41,42)/b28-26+,29-27+ |
| InChIKey | SHQXEZMUTPOKRP-TUUFZWAFSA-N |
| XLogP | 2.57 |
| TPSA | 337.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.82 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|