C22H24N6O15S5 — CID 89366408
2-[[2,4-diamino-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]-5-(2-sulfooxyethylsulfonyl)benzenesulfonic acid (PubChem CID 89366408) has the molecular formula C22H24N6O15S5 and a molecular weight of 772.80 g/mol. Its IUPAC name is 2-[[2,4-diamino-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]-5-(2-sulfooxyethylsulfonyl)benzenesulfonic acid.
| Compound Name | 2-[[2,4-diamino-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]-5-(2-sulfooxyethylsulfonyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 89366408 |
| Molecular Formula | C22H24N6O15S5 |
| Molecular Weight | 772.80 g/mol |
| Exact Mass | 771.99 |
| IUPAC Name | 2-[[2,4-diamino-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]-5-(2-sulfooxyethylsulfonyl)benzenesulfonic acid |
| SMILES | Nc1cc(N)c(/N=N/c2ccc(S(=O)(=O)CCOS(=O)(=O)O)cc2S(=O)(=O)O)cc1/N=N/c1ccc(S(=O)(=O)CCOS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C22H24N6O15S5/c23-17-12-18(24)21(13-20(17)27-25-14-1-3-15(4-2-14)44(29,30)9-7-42-47(36,37)38)28-26-19-6-5-16(11-22(19)46(33,34)35)45(31,32)10-8-43-48(39,40)41/h1-6,11-13H,7-10,23-24H2,(H,33,34,35)(H,36,37,38)(H,39,40,41)/b27-25+,28-26+ |
| InChIKey | LINGMACQEQWAQQ-NBHCHVEOSA-N |
| XLogP | 2.11 |
| TPSA | 351.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.80 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|