C17H17FN6O9S3 — CID 59668426
2-amino-4-[[4-fluoro-6-[4-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]anilino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 59668426) has the molecular formula C17H17FN6O9S3 and a molecular weight of 564.56 g/mol. Its IUPAC name is 2-amino-4-[[4-fluoro-6-[4-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]anilino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 2-amino-4-[[4-fluoro-6-[4-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]anilino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 59668426 |
| Molecular Formula | C17H17FN6O9S3 |
| Molecular Weight | 564.56 g/mol |
| Exact Mass | 564.02 |
| IUPAC Name | 2-amino-4-[[4-fluoro-6-[4-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]anilino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | Nc1cc(Nc2nc(F)nc(Nc3ccc(S(=O)(=O)CCOSOOO)cc3)n2)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C17H17FN6O9S3/c18-15-22-16(24-17(23-15)21-11-3-6-14(13(19)9-11)36(28,29)30)20-10-1-4-12(5-2-10)35(26,27)8-7-31-34-33-32-25/h1-6,9,25H,7-8,19H2,(H,28,29,30)(H2,20,21,22,23,24) |
| InChIKey | ZEHOIICWKPCRQD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 225.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.56 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|