C19H21ClN6O9S3 — CID 59847223
2-amino-4-[[4-chloro-6-[N-ethyl-4-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 59847223) has the molecular formula C19H21ClN6O9S3 and a molecular weight of 609.06 g/mol. Its IUPAC name is 2-amino-4-[[4-chloro-6-[N-ethyl-4-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 2-amino-4-[[4-chloro-6-[N-ethyl-4-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 59847223 |
| Molecular Formula | C19H21ClN6O9S3 |
| Molecular Weight | 609.06 g/mol |
| Exact Mass | 608.02 |
| IUPAC Name | 2-amino-4-[[4-chloro-6-[N-ethyl-4-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | CCN(c1ccc(S(=O)(=O)CCOS(=O)(=O)O)cc1)c1nc(Cl)nc(Nc2ccc(S(=O)(=O)O)c(N)c2)n1 |
| InChI | InChI=1S/C19H21ClN6O9S3/c1-2-26(13-4-6-14(7-5-13)36(27,28)10-9-35-38(32,33)34)19-24-17(20)23-18(25-19)22-12-3-8-16(15(21)11-12)37(29,30)31/h3-8,11H,2,9-10,21H2,1H3,(H,29,30,31)(H,32,33,34)(H,22,23,24,25) |
| InChIKey | MUKAYWATXVOXSJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 232.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.06 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|