C18H18ClN5O8S3 — CID 59858630
4-[[4-chloro-6-[4-[2-(trioxidanylsulfanyl)ethylsulfonyl]anilino]-1,3,5-triazin-2-yl]amino]-2-methylbenzenesulfonic acid (PubChem CID 59858630) has the molecular formula C18H18ClN5O8S3 and a molecular weight of 564.02 g/mol. Its IUPAC name is 4-[[4-chloro-6-[4-[2-(trioxidanylsulfanyl)ethylsulfonyl]anilino]-1,3,5-triazin-2-yl]amino]-2-methylbenzenesulfonic acid.
| Compound Name | 4-[[4-chloro-6-[4-[2-(trioxidanylsulfanyl)ethylsulfonyl]anilino]-1,3,5-triazin-2-yl]amino]-2-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 59858630 |
| Molecular Formula | C18H18ClN5O8S3 |
| Molecular Weight | 564.02 g/mol |
| Exact Mass | 563.00 |
| IUPAC Name | 4-[[4-chloro-6-[4-[2-(trioxidanylsulfanyl)ethylsulfonyl]anilino]-1,3,5-triazin-2-yl]amino]-2-methylbenzenesulfonic acid |
| SMILES | Cc1cc(Nc2nc(Cl)nc(Nc3ccc(S(=O)(=O)CCSOOO)cc3)n2)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C18H18ClN5O8S3/c1-11-10-13(4-7-15(11)35(28,29)30)21-18-23-16(19)22-17(24-18)20-12-2-5-14(6-3-12)34(26,27)9-8-33-32-31-25/h2-7,10,25H,8-9H2,1H3,(H,28,29,30)(H2,20,21,22,23,24) |
| InChIKey | PLHXOOMMNVJTIM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 189.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.02 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|