C18H18FN7O7S2 — CID 165340135
2-[4-[[4-(4-amino-3-carbamoylanilino)-6-fluoro-1,3,5-triazin-2-yl]amino]phenyl]sulfonylethyl hydrogen sulfate (PubChem CID 165340135) has the molecular formula C18H18FN7O7S2 and a molecular weight of 527.52 g/mol. Its IUPAC name is 2-[4-[[4-(4-amino-3-carbamoylanilino)-6-fluoro-1,3,5-triazin-2-yl]amino]phenyl]sulfonylethyl hydrogen sulfate.
| Compound Name | 2-[4-[[4-(4-amino-3-carbamoylanilino)-6-fluoro-1,3,5-triazin-2-yl]amino]phenyl]sulfonylethyl hydrogen sulfate |
|---|---|
| PubChem CID | 165340135 |
| Molecular Formula | C18H18FN7O7S2 |
| Molecular Weight | 527.52 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | 2-[4-[[4-(4-amino-3-carbamoylanilino)-6-fluoro-1,3,5-triazin-2-yl]amino]phenyl]sulfonylethyl hydrogen sulfate |
| SMILES | NC(=O)c1cc(Nc2nc(F)nc(Nc3ccc(S(=O)(=O)CCOS(=O)(=O)O)cc3)n2)ccc1N |
| InChI | InChI=1S/C18H18FN7O7S2/c19-16-24-17(26-18(25-16)23-11-3-6-14(20)13(9-11)15(21)27)22-10-1-4-12(5-2-10)34(28,29)8-7-33-35(30,31)32/h1-6,9H,7-8,20H2,(H2,21,27)(H,30,31,32)(H2,22,23,24,25,26) |
| InChIKey | HOQSJRGBVOVTOJ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 229.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.52 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|