C30H32BClFN14O9S2 — CID 135796517
CID 135796517 (PubChem CID 135796517) has the molecular formula C30H32BClFN14O9S2 and a molecular weight of 862.07 g/mol.
| Compound Name | CID 135796517 |
|---|---|
| PubChem CID | 135796517 |
| Molecular Formula | C30H32BClFN14O9S2 |
| Molecular Weight | 862.07 g/mol |
| Exact Mass | 861.17 |
| IUPAC Name | — |
| SMILES | CCn1c(O)c(CON)c(C)c(/N=N/c2cc(Nc3nc(Cl)nc(N[B]Nc4nc(F)nc(Nc5ccc(S(=O)(=O)CCOS(=O)(=O)O)cc5)n4)n3)ccc2C)c1=O |
| InChI | InChI=1S/C30H32BClFN14O9S2/c1-4-47-23(48)20(14-55-34)16(3)22(24(47)49)46-45-21-13-18(6-5-15(21)2)36-27-37-25(32)38-29(41-27)43-31-44-30-40-26(33)39-28(42-30)35-17-7-9-19(10-8-17)57(50,51)12-11-56-58(52,53)54/h5-10,13,48H,4,11-12,14,34H2,1-3H3,(H,52,53,54)(H2,35,39,40,42,44)(H2,36,37,38,41,43)/b46-45+ |
| InChIKey | UQGMNQRKCHRLNT-XVIFHXHVSA-N |
| XLogP | 3.30 |
| TPSA | 325.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.07 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|