C25H25FN8O13S4 — CID 135430264
2-[[4-fluoro-6-[4-(2-sulfoethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]-4-[[6-hydroxy-1,4-dimethyl-2-oxo-5-(sulfomethyl)-3-pyridinyl]diazenyl]benzenesulfonic acid (PubChem CID 135430264) has the molecular formula C25H25FN8O13S4 and a molecular weight of 792.78 g/mol. Its IUPAC name is 2-[[4-fluoro-6-[4-(2-sulfoethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]-4-[[6-hydroxy-1,4-dimethyl-2-oxo-5-(sulfomethyl)-3-pyridinyl]diazenyl]benzenesulfonic acid.
| Compound Name | 2-[[4-fluoro-6-[4-(2-sulfoethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]-4-[[6-hydroxy-1,4-dimethyl-2-oxo-5-(sulfomethyl)-3-pyridinyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135430264 |
| Molecular Formula | C25H25FN8O13S4 |
| Molecular Weight | 792.78 g/mol |
| Exact Mass | 792.04 |
| IUPAC Name | 2-[[4-fluoro-6-[4-(2-sulfoethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]-4-[[6-hydroxy-1,4-dimethyl-2-oxo-5-(sulfomethyl)-3-pyridinyl]diazenyl]benzenesulfonic acid |
| SMILES | Cc1c(CS(=O)(=O)O)c(O)n(C)c(=O)c1/N=N/c1ccc(S(=O)(=O)O)c(Nc2nc(F)nc(Nc3ccc(S(=O)(=O)CCS(=O)(=O)O)cc3)n2)c1 |
| InChI | InChI=1S/C25H25FN8O13S4/c1-13-17(12-50(42,43)44)21(35)34(2)22(36)20(13)33-32-15-5-8-19(51(45,46)47)18(11-15)28-25-30-23(26)29-24(31-25)27-14-3-6-16(7-4-14)48(37,38)9-10-49(39,40)41/h3-8,11,35H,9-10,12H2,1-2H3,(H,39,40,41)(H,42,43,44)(H,45,46,47)(H2,27,28,29,30,31)/b33-32+ |
| InChIKey | CMYUUSQGHCVLQY-ULIFNZDWSA-N |
| XLogP | 1.92 |
| TPSA | 326.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.78 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|