C31H30N10O11S3 — CID 144569056
4-methoxy-3-[[4-[[4-[4-[(2-methoxy-5-sulfophenyl)diazenyl]anilino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]benzenesulfonic acid (PubChem CID 144569056) has the molecular formula C31H30N10O11S3 and a molecular weight of 814.84 g/mol. Its IUPAC name is 4-methoxy-3-[[4-[[4-[4-[(2-methoxy-5-sulfophenyl)diazenyl]anilino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-methoxy-3-[[4-[[4-[4-[(2-methoxy-5-sulfophenyl)diazenyl]anilino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 144569056 |
| Molecular Formula | C31H30N10O11S3 |
| Molecular Weight | 814.84 g/mol |
| Exact Mass | 814.13 |
| IUPAC Name | 4-methoxy-3-[[4-[[4-[4-[(2-methoxy-5-sulfophenyl)diazenyl]anilino]-6-(2-sulfoethylamino)-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]benzenesulfonic acid |
| SMILES | COc1ccc(S(=O)(=O)O)cc1/N=N/c1ccc(Nc2nc(NCCS(=O)(=O)O)nc(Nc3ccc(/N=N/c4cc(S(=O)(=O)O)ccc4OC)cc3)n2)cc1 |
| InChI | InChI=1S/C31H30N10O11S3/c1-51-27-13-11-23(54(45,46)47)17-25(27)40-38-21-7-3-19(4-8-21)33-30-35-29(32-15-16-53(42,43)44)36-31(37-30)34-20-5-9-22(10-6-20)39-41-26-18-24(55(48,49)50)12-14-28(26)52-2/h3-14,17-18H,15-16H2,1-2H3,(H,42,43,44)(H,45,46,47)(H,48,49,50)(H3,32,33,34,35,36,37)/b40-38+,41-39+ |
| InChIKey | SXEKDUMFEDJFJF-QYGUTFKISA-N |
| XLogP | 6.00 |
| TPSA | 305.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.84 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|