C24H21ClFN9O9S2 — CID 136638169
3-[[4-[3-[(5-carbamoyl-1-ethyl-2-hydroxy-4-methyl-6-oxo-3-pyridinyl)diazenyl]-4-(trioxidanylsulfanyl)anilino]-6-fluoro-1,3,5-triazin-2-yl]amino]-4-chlorobenzenesulfonic acid (PubChem CID 136638169) has the molecular formula C24H21ClFN9O9S2 and a molecular weight of 698.07 g/mol. Its IUPAC name is 3-[[4-[3-[(5-carbamoyl-1-ethyl-2-hydroxy-4-methyl-6-oxo-3-pyridinyl)diazenyl]-4-(trioxidanylsulfanyl)anilino]-6-fluoro-1,3,5-triazin-2-yl]amino]-4-chlorobenzenesulfonic acid.
| Compound Name | 3-[[4-[3-[(5-carbamoyl-1-ethyl-2-hydroxy-4-methyl-6-oxo-3-pyridinyl)diazenyl]-4-(trioxidanylsulfanyl)anilino]-6-fluoro-1,3,5-triazin-2-yl]amino]-4-chlorobenzenesulfonic acid |
|---|---|
| PubChem CID | 136638169 |
| Molecular Formula | C24H21ClFN9O9S2 |
| Molecular Weight | 698.07 g/mol |
| Exact Mass | 697.06 |
| IUPAC Name | 3-[[4-[3-[(5-carbamoyl-1-ethyl-2-hydroxy-4-methyl-6-oxo-3-pyridinyl)diazenyl]-4-(trioxidanylsulfanyl)anilino]-6-fluoro-1,3,5-triazin-2-yl]amino]-4-chlorobenzenesulfonic acid |
| SMILES | CCn1c(O)c(/N=N/c2cc(Nc3nc(F)nc(Nc4cc(S(=O)(=O)O)ccc4Cl)n3)ccc2SOOO)c(C)c(C(N)=O)c1=O |
| InChI | InChI=1S/C24H21ClFN9O9S2/c1-3-35-20(37)17(19(27)36)10(2)18(21(35)38)34-33-15-8-11(4-7-16(15)45-44-43-39)28-23-30-22(26)31-24(32-23)29-14-9-12(46(40,41)42)5-6-13(14)25/h4-9,38-39H,3H2,1-2H3,(H2,27,36)(H,40,41,42)(H2,28,29,30,31,32)/b34-33+ |
| InChIKey | NLAOXJMSAVGECW-JEIPZWNWSA-N |
| XLogP | 4.54 |
| TPSA | 265.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.07 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|