C39H40F2LiN18NaO18S4 — CID 170839014
CID 170839014 (PubChem CID 170839014) has the molecular formula C39H40F2LiN18NaO18S4 and a molecular weight of 1245.05 g/mol.
| Compound Name | CID 170839014 |
|---|---|
| PubChem CID | 170839014 |
| Molecular Formula | C39H40F2LiN18NaO18S4 |
| Molecular Weight | 1245.05 g/mol |
| Exact Mass | 1244.17 |
| IUPAC Name | — |
| SMILES | CCn1c(O)c(C(N)=O)c(C)c(/N=N/c2cc(Nc3nc(F)nc(NCCCNc4nc(F)nc(Nc5cc(/N=N/c6c(C)c(C(N)=O)c(O)n(CC)c6=O)c(S(=O)(=O)O)cc5S(=O)(=O)O)n4)n3)c(S(=O)(=O)O)cc2S(=O)(=O)O)c1=O.[Li].[Na] |
| InChI | InChI=1S/C39H40F2N18O18S4.Li.Na/c1-5-58-30(62)24(28(42)60)14(3)26(32(58)64)56-54-18-10-16(20(78(66,67)68)12-22(18)80(72,73)74)46-38-50-34(40)48-36(52-38)44-8-7-9-45-37-49-35(41)51-39(53-37)47-17-11-19(23(81(75,76)77)13-21(17)79(69,70)71)55-57-27-15(4)25(29(43)61)31(63)59(6-2)33(27)65;;/h10-13,62-63H,5-9H2,1-4H3,(H2,42,60)(H2,43,61)(H,66,67,68)(H,69,70,71)(H,72,73,74)(H,75,76,77)(H2,44,46,48,50,52)(H2,45,47,49,51,53);;/b56-54+,57-55+;; |
| InChIKey | RCLLBGOLNUUVOK-UKOSMXAASA-N |
| XLogP | 1.38 |
| TPSA | 563.02 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 30 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 83 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1245.05 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 30 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|