C15H14N4O8S2 — CID 3018411
4-[(5-cyano-1-ethyl-6-hydroxy-4-methyl-2-oxo-3-pyridinyl)diazenyl]benzene-1,3-disulfonic acid (PubChem CID 3018411) has the molecular formula C15H14N4O8S2 and a molecular weight of 442.43 g/mol. Its IUPAC name is 4-[(5-cyano-1-ethyl-6-hydroxy-4-methyl-2-oxo-3-pyridinyl)diazenyl]benzene-1,3-disulfonic acid.
| Compound Name | 4-[(5-cyano-1-ethyl-6-hydroxy-4-methyl-2-oxo-3-pyridinyl)diazenyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 3018411 |
| Molecular Formula | C15H14N4O8S2 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 4-[(5-cyano-1-ethyl-6-hydroxy-4-methyl-2-oxo-3-pyridinyl)diazenyl]benzene-1,3-disulfonic acid |
| SMILES | CCn1c(O)c(C#N)c(C)c(/N=N/c2ccc(S(=O)(=O)O)cc2S(=O)(=O)O)c1=O |
| InChI | InChI=1S/C15H14N4O8S2/c1-3-19-14(20)10(7-16)8(2)13(15(19)21)18-17-11-5-4-9(28(22,23)24)6-12(11)29(25,26)27/h4-6,20H,3H2,1-2H3,(H,22,23,24)(H,25,26,27)/b18-17+ |
| InChIKey | RRKBVRQHWWFJBZ-ISLYRVAYSA-N |
| XLogP | 1.66 |
| TPSA | 199.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|