C33H39ClN8Na2O10S2 — CID 170840316
CID 170840316 (PubChem CID 170840316) has the molecular formula C33H39ClN8Na2O10S2 and a molecular weight of 853.29 g/mol.
| Compound Name | CID 170840316 |
|---|---|
| PubChem CID | 170840316 |
| Molecular Formula | C33H39ClN8Na2O10S2 |
| Molecular Weight | 853.29 g/mol |
| Exact Mass | 852.17 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCc1ccc(Oc2nc(Cl)nc(Nc3cc(/N=N/c4c(C)c(C(N)=O)c(O)n(CC)c4=O)c(S(=O)(=O)O)cc3S(=O)(=O)O)n2)cc1.[Na].[Na] |
| InChI | InChI=1S/C33H39ClN8O10S2.2Na/c1-4-6-7-8-9-10-11-12-20-13-15-21(16-14-20)52-33-38-31(34)37-32(39-33)36-22-17-23(25(54(49,50)51)18-24(22)53(46,47)48)40-41-27-19(3)26(28(35)43)29(44)42(5-2)30(27)45;;/h13-18,44H,4-12H2,1-3H3,(H2,35,43)(H,46,47,48)(H,49,50,51)(H,36,37,38,39);;/b41-40+;; |
| InChIKey | CRCWYHHDAHCCJP-GDXDGRBBSA-N |
| XLogP | 5.80 |
| TPSA | 278.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.29 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|