C28H26Cl2N10O6S2 — CID 44551130
4,6-bis[[4-chloro-6-(2-phenylethylamino)-1,3,5-triazin-2-yl]amino]benzene-1,3-disulfonic acid (PubChem CID 44551130) has the molecular formula C28H26Cl2N10O6S2 and a molecular weight of 733.62 g/mol. Its IUPAC name is 4,6-bis[[4-chloro-6-(2-phenylethylamino)-1,3,5-triazin-2-yl]amino]benzene-1,3-disulfonic acid.
| Compound Name | 4,6-bis[[4-chloro-6-(2-phenylethylamino)-1,3,5-triazin-2-yl]amino]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 44551130 |
| Molecular Formula | C28H26Cl2N10O6S2 |
| Molecular Weight | 733.62 g/mol |
| Exact Mass | 732.09 |
| IUPAC Name | 4,6-bis[[4-chloro-6-(2-phenylethylamino)-1,3,5-triazin-2-yl]amino]benzene-1,3-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc(S(=O)(=O)O)c(Nc2nc(Cl)nc(NCCc3ccccc3)n2)cc1Nc1nc(Cl)nc(NCCc2ccccc2)n1 |
| InChI | InChI=1S/C28H26Cl2N10O6S2/c29-23-35-25(31-13-11-17-7-3-1-4-8-17)39-27(37-23)33-19-15-20(22(48(44,45)46)16-21(19)47(41,42)43)34-28-38-24(30)36-26(40-28)32-14-12-18-9-5-2-6-10-18/h1-10,15-16H,11-14H2,(H,41,42,43)(H,44,45,46)(H2,31,33,35,37,39)(H2,32,34,36,38,40) |
| InChIKey | YDHUUOMRKMKKQW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 234.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.62 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|