C27H31Cl2N11O9S3 — CID 21343186
4-[[4-chloro-6-[4-[2-[[4-chloro-6-(4,5-dimethyl-2-sulfoanilino)-1,3,5-triazin-2-yl]amino]ethyl]piperazin-1-yl]-1,3,5-triazin-2-yl]amino]-6-methylbenzene-1,3-disulfonic acid (PubChem CID 21343186) has the molecular formula C27H31Cl2N11O9S3 and a molecular weight of 820.72 g/mol. Its IUPAC name is 4-[[4-chloro-6-[4-[2-[[4-chloro-6-(4,5-dimethyl-2-sulfoanilino)-1,3,5-triazin-2-yl]amino]ethyl]piperazin-1-yl]-1,3,5-triazin-2-yl]amino]-6-methylbenzene-1,3-disulfonic acid.
| Compound Name | 4-[[4-chloro-6-[4-[2-[[4-chloro-6-(4,5-dimethyl-2-sulfoanilino)-1,3,5-triazin-2-yl]amino]ethyl]piperazin-1-yl]-1,3,5-triazin-2-yl]amino]-6-methylbenzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 21343186 |
| Molecular Formula | C27H31Cl2N11O9S3 |
| Molecular Weight | 820.72 g/mol |
| Exact Mass | 819.08 |
| IUPAC Name | 4-[[4-chloro-6-[4-[2-[[4-chloro-6-(4,5-dimethyl-2-sulfoanilino)-1,3,5-triazin-2-yl]amino]ethyl]piperazin-1-yl]-1,3,5-triazin-2-yl]amino]-6-methylbenzene-1,3-disulfonic acid |
| SMILES | Cc1cc(Nc2nc(Cl)nc(NCCN3CCN(c4nc(Cl)nc(Nc5cc(C)c(S(=O)(=O)O)cc5S(=O)(=O)O)n4)CC3)n2)c(S(=O)(=O)O)cc1C |
| InChI | InChI=1S/C27H31Cl2N11O9S3/c1-14-10-17(20(12-15(14)2)51(44,45)46)31-25-34-22(28)33-24(37-25)30-4-5-39-6-8-40(9-7-39)27-36-23(29)35-26(38-27)32-18-11-16(3)19(50(41,42)43)13-21(18)52(47,48)49/h10-13H,4-9H2,1-3H3,(H,41,42,43)(H,44,45,46)(H,47,48,49)(H,32,35,36,38)(H2,30,31,33,34,37) |
| InChIKey | HHCYSYKVEFUTIS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 283.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.72 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|