C18H18ClN5O4S — CID 88871968
8-[(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-5-methylnaphthalene-1-sulfonic acid (PubChem CID 88871968) has the molecular formula C18H18ClN5O4S and a molecular weight of 435.89 g/mol. Its IUPAC name is 8-[(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-5-methylnaphthalene-1-sulfonic acid.
| Compound Name | 8-[(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-5-methylnaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 88871968 |
| Molecular Formula | C18H18ClN5O4S |
| Molecular Weight | 435.89 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 8-[(4-chloro-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-5-methylnaphthalene-1-sulfonic acid |
| SMILES | Cc1ccc(Nc2nc(Cl)nc(N3CCOCC3)n2)c2c(S(=O)(=O)O)cccc12 |
| InChI | InChI=1S/C18H18ClN5O4S/c1-11-5-6-13(15-12(11)3-2-4-14(15)29(25,26)27)20-17-21-16(19)22-18(23-17)24-7-9-28-10-8-24/h2-6H,7-10H2,1H3,(H,25,26,27)(H,20,21,22,23) |
| InChIKey | CQHOQPCXPSPOGQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.89 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|