C25H28Cl2N12O6S2 — CID 165366231
2-amino-4-[[4-[2-[1-[4-(3-amino-4-sulfoanilino)-6-chloro-1,3,5-triazin-2-yl]piperidin-4-yl]ethylamino]-6-chloro-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 165366231) has the molecular formula C25H28Cl2N12O6S2 and a molecular weight of 727.62 g/mol. Its IUPAC name is 2-amino-4-[[4-[2-[1-[4-(3-amino-4-sulfoanilino)-6-chloro-1,3,5-triazin-2-yl]piperidin-4-yl]ethylamino]-6-chloro-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 2-amino-4-[[4-[2-[1-[4-(3-amino-4-sulfoanilino)-6-chloro-1,3,5-triazin-2-yl]piperidin-4-yl]ethylamino]-6-chloro-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 165366231 |
| Molecular Formula | C25H28Cl2N12O6S2 |
| Molecular Weight | 727.62 g/mol |
| Exact Mass | 726.11 |
| IUPAC Name | 2-amino-4-[[4-[2-[1-[4-(3-amino-4-sulfoanilino)-6-chloro-1,3,5-triazin-2-yl]piperidin-4-yl]ethylamino]-6-chloro-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | Nc1cc(Nc2nc(Cl)nc(NCCC3CCN(c4nc(Cl)nc(Nc5ccc(S(=O)(=O)O)c(N)c5)n4)CC3)n2)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C25H28Cl2N12O6S2/c26-20-33-22(37-23(34-20)31-14-1-3-18(16(28)11-14)46(40,41)42)30-8-5-13-6-9-39(10-7-13)25-36-21(27)35-24(38-25)32-15-2-4-19(17(29)12-15)47(43,44)45/h1-4,11-13H,5-10,28-29H2,(H,40,41,42)(H,43,44,45)(H,32,35,36,38)(H2,30,31,33,34,37) |
| InChIKey | PTJMTEYPPDMITG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 277.45 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.62 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|