C21H22N4O — CID 59779304
N-[2-[(4,8-dimethylnaphthalen-2-yl)diazenyl]-5-(methylamino)phenyl]acetamide (PubChem CID 59779304) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[2-[(4,8-dimethylnaphthalen-2-yl)diazenyl]-5-(methylamino)phenyl]acetamide.
| Compound Name | N-[2-[(4,8-dimethylnaphthalen-2-yl)diazenyl]-5-(methylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 59779304 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | N-[2-[(4,8-dimethylnaphthalen-2-yl)diazenyl]-5-(methylamino)phenyl]acetamide |
| SMILES | CNc1ccc(/N=N/c2cc(C)c3cccc(C)c3c2)c(NC(C)=O)c1 |
| InChI | InChI=1S/C21H22N4O/c1-13-6-5-7-18-14(2)10-17(11-19(13)18)24-25-20-9-8-16(22-4)12-21(20)23-15(3)26/h5-12,22H,1-4H3,(H,23,26)/b25-24+ |
| InChIKey | RCDASKOMEVMFKY-OCOZRVBESA-N |
| XLogP | 5.87 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|