C19H26N4O7S2 — CID 90949729
N-[5-(methylamino)-2-[(2-methylphenyl)diazenyl]phenyl]acetamide;1-methylsulfonyl-2-(trioxidanylsulfanyloxy)ethane (PubChem CID 90949729) has the molecular formula C19H26N4O7S2 and a molecular weight of 486.57 g/mol. Its IUPAC name is N-[5-(methylamino)-2-[(2-methylphenyl)diazenyl]phenyl]acetamide;1-methylsulfonyl-2-(trioxidanylsulfanyloxy)ethane.
| Compound Name | N-[5-(methylamino)-2-[(2-methylphenyl)diazenyl]phenyl]acetamide;1-methylsulfonyl-2-(trioxidanylsulfanyloxy)ethane |
|---|---|
| PubChem CID | 90949729 |
| Molecular Formula | C19H26N4O7S2 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | N-[5-(methylamino)-2-[(2-methylphenyl)diazenyl]phenyl]acetamide;1-methylsulfonyl-2-(trioxidanylsulfanyloxy)ethane |
| SMILES | CNc1ccc(/N=N/c2ccccc2C)c(NC(C)=O)c1.CS(=O)(=O)CCOSOOO |
| InChI | InChI=1S/C16H18N4O.C3H8O6S2/c1-11-6-4-5-7-14(11)19-20-15-9-8-13(17-3)10-16(15)18-12(2)21;1-11(5,6)3-2-7-10-9-8-4/h4-10,17H,1-3H3,(H,18,21);4H,2-3H2,1H3/b20-19+; |
| InChIKey | ORAQAFLCVZNXQO-RZLHGTIFSA-N |
| XLogP | 4.44 |
| TPSA | 147.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|