C14H14N4O4S — CID 59847237
N-[5-amino-2-[[3-(trioxidanylsulfanyl)phenyl]diazenyl]phenyl]acetamide (PubChem CID 59847237) has the molecular formula C14H14N4O4S and a molecular weight of 334.36 g/mol. Its IUPAC name is N-[5-amino-2-[[3-(trioxidanylsulfanyl)phenyl]diazenyl]phenyl]acetamide.
| Compound Name | N-[5-amino-2-[[3-(trioxidanylsulfanyl)phenyl]diazenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 59847237 |
| Molecular Formula | C14H14N4O4S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | N-[5-amino-2-[[3-(trioxidanylsulfanyl)phenyl]diazenyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(N)ccc1/N=N/c1cccc(SOOO)c1 |
| InChI | InChI=1S/C14H14N4O4S/c1-9(19)16-14-7-10(15)5-6-13(14)18-17-11-3-2-4-12(8-11)23-22-21-20/h2-8,20H,15H2,1H3,(H,16,19)/b18-17+ |
| InChIKey | GCGOHCURWDZTQD-ISLYRVAYSA-N |
| XLogP | 4.07 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|