C22H25N5O3 — CID 15218269
butyl 3-[[2-acetamido-4-(2-cyanoethylamino)phenyl]diazenyl]benzoate (PubChem CID 15218269) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is butyl 3-[[2-acetamido-4-(2-cyanoethylamino)phenyl]diazenyl]benzoate.
| Compound Name | butyl 3-[[2-acetamido-4-(2-cyanoethylamino)phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 15218269 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | butyl 3-[[2-acetamido-4-(2-cyanoethylamino)phenyl]diazenyl]benzoate |
| SMILES | CCCCOC(=O)c1cccc(/N=N/c2ccc(NCCC#N)cc2NC(C)=O)c1 |
| InChI | InChI=1S/C22H25N5O3/c1-3-4-13-30-22(29)17-7-5-8-19(14-17)26-27-20-10-9-18(24-12-6-11-23)15-21(20)25-16(2)28/h5,7-10,14-15,24H,3-4,6,12-13H2,1-2H3,(H,25,28)/b27-26+ |
| InChIKey | WQMGECZJFSIWKR-CYYJNZCTSA-N |
| XLogP | 5.34 |
| TPSA | 115.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|