C17H15N5O10S3 — CID 20764585
7-[[4-amino-2-(carbamoylamino)phenyl]diazenyl]-3-(trioxidanylsulfanyl)naphthalene-1,6-disulfonic acid (PubChem CID 20764585) has the molecular formula C17H15N5O10S3 and a molecular weight of 545.53 g/mol. Its IUPAC name is 7-[[4-amino-2-(carbamoylamino)phenyl]diazenyl]-3-(trioxidanylsulfanyl)naphthalene-1,6-disulfonic acid.
| Compound Name | 7-[[4-amino-2-(carbamoylamino)phenyl]diazenyl]-3-(trioxidanylsulfanyl)naphthalene-1,6-disulfonic acid |
|---|---|
| PubChem CID | 20764585 |
| Molecular Formula | C17H15N5O10S3 |
| Molecular Weight | 545.53 g/mol |
| Exact Mass | 545.00 |
| IUPAC Name | 7-[[4-amino-2-(carbamoylamino)phenyl]diazenyl]-3-(trioxidanylsulfanyl)naphthalene-1,6-disulfonic acid |
| SMILES | NC(=O)Nc1cc(N)ccc1/N=N/c1cc2c(S(=O)(=O)O)cc(SOOO)cc2cc1S(=O)(=O)O |
| InChI | InChI=1S/C17H15N5O10S3/c18-9-1-2-12(13(5-9)20-17(19)23)21-22-14-7-11-8(4-16(14)35(28,29)30)3-10(33-32-31-24)6-15(11)34(25,26)27/h1-7,24H,18H2,(H3,19,20,23)(H,25,26,27)(H,28,29,30)/b22-21+ |
| InChIKey | FQVAZIGBQAWRIO-QURGRASLSA-N |
| XLogP | 3.25 |
| TPSA | 253.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|