C15H15N5Na2O10S3 — CID 165363363
disodium;2-[[4-amino-2-(carbamoylamino)phenyl]diazenyl]-5-(2-sulfonatooxyethylsulfonyl)benzenesulfonate (PubChem CID 165363363) has the molecular formula C15H15N5Na2O10S3 and a molecular weight of 567.49 g/mol. Its IUPAC name is disodium;2-[[4-amino-2-(carbamoylamino)phenyl]diazenyl]-5-(2-sulfonatooxyethylsulfonyl)benzenesulfonate.
| Compound Name | disodium;2-[[4-amino-2-(carbamoylamino)phenyl]diazenyl]-5-(2-sulfonatooxyethylsulfonyl)benzenesulfonate |
|---|---|
| PubChem CID | 165363363 |
| Molecular Formula | C15H15N5Na2O10S3 |
| Molecular Weight | 567.49 g/mol |
| Exact Mass | 566.98 |
| IUPAC Name | disodium;2-[[4-amino-2-(carbamoylamino)phenyl]diazenyl]-5-(2-sulfonatooxyethylsulfonyl)benzenesulfonate |
| SMILES | NC(=O)Nc1cc(N)ccc1/N=N/c1ccc(S(=O)(=O)CCOS(=O)(=O)[O-])cc1S(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C15H17N5O10S3.2Na/c16-9-1-3-11(13(7-9)18-15(17)21)19-20-12-4-2-10(8-14(12)32(24,25)26)31(22,23)6-5-30-33(27,28)29;;/h1-4,7-8H,5-6,16H2,(H3,17,18,21)(H,24,25,26)(H,27,28,29);;/q;2*+1/p-2/b20-19+;; |
| InChIKey | ZRFUYFGAMILLHZ-LLIZZRELSA-L |
| XLogP | -5.66 |
| TPSA | 263.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.49 |
| LogP ≤ 5 | -5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|