C10H8O10S3 — CID 58969629
3-hydroxy-5,7-bis(trioxidanylsulfanyl)naphthalene-2-sulfonic acid (PubChem CID 58969629) has the molecular formula C10H8O10S3 and a molecular weight of 384.37 g/mol. Its IUPAC name is 3-hydroxy-5,7-bis(trioxidanylsulfanyl)naphthalene-2-sulfonic acid.
| Compound Name | 3-hydroxy-5,7-bis(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 58969629 |
| Molecular Formula | C10H8O10S3 |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 383.93 |
| IUPAC Name | 3-hydroxy-5,7-bis(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc2cc(SOOO)cc(SOOO)c2cc1O |
| InChI | InChI=1S/C10H8O10S3/c11-8-4-7-5(2-10(8)23(14,15)16)1-6(21-19-17-12)3-9(7)22-20-18-13/h1-4,11-13H,(H,14,15,16) |
| InChIKey | XRMUPIQYXWBCCL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|