C10H7FN2O6S2 — CID 58661258
2-fluoro-7-(trioxidanylsulfanyl)-1H-naphtho[1,2-c]diazete-5-sulfonic acid (PubChem CID 58661258) has the molecular formula C10H7FN2O6S2 and a molecular weight of 334.31 g/mol. Its IUPAC name is 2-fluoro-7-(trioxidanylsulfanyl)-1H-naphtho[1,2-c]diazete-5-sulfonic acid.
| Compound Name | 2-fluoro-7-(trioxidanylsulfanyl)-1H-naphtho[1,2-c]diazete-5-sulfonic acid |
|---|---|
| PubChem CID | 58661258 |
| Molecular Formula | C10H7FN2O6S2 |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | 2-fluoro-7-(trioxidanylsulfanyl)-1H-naphtho[1,2-c]diazete-5-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc(SOOO)cc2c1ccc1c2[nH]n1F |
| InChI | InChI=1S/C10H7FN2O6S2/c11-13-8-2-1-6-7(10(8)12-13)3-5(20-19-18-14)4-9(6)21(15,16)17/h1-4,12,14H,(H,15,16,17) |
| InChIKey | QQDJNPMAGTWQIM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|