C20H18N2O12S3 — CID 21029288
8-[(2,4,6-trimethyl-3-nitrobenzoyl)amino]-3-(trioxidanylsulfanyl)naphthalene-1,5-disulfonic acid (PubChem CID 21029288) has the molecular formula C20H18N2O12S3 and a molecular weight of 574.57 g/mol. Its IUPAC name is 8-[(2,4,6-trimethyl-3-nitrobenzoyl)amino]-3-(trioxidanylsulfanyl)naphthalene-1,5-disulfonic acid.
| Compound Name | 8-[(2,4,6-trimethyl-3-nitrobenzoyl)amino]-3-(trioxidanylsulfanyl)naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 21029288 |
| Molecular Formula | C20H18N2O12S3 |
| Molecular Weight | 574.57 g/mol |
| Exact Mass | 574.00 |
| IUPAC Name | 8-[(2,4,6-trimethyl-3-nitrobenzoyl)amino]-3-(trioxidanylsulfanyl)naphthalene-1,5-disulfonic acid |
| SMILES | Cc1cc(C)c([N+](=O)[O-])c(C)c1C(=O)Nc1ccc(S(=O)(=O)O)c2cc(SOOO)cc(S(=O)(=O)O)c12 |
| InChI | InChI=1S/C20H18N2O12S3/c1-9-6-10(2)19(22(24)25)11(3)17(9)20(23)21-14-4-5-15(36(27,28)29)13-7-12(35-34-33-26)8-16(18(13)14)37(30,31)32/h4-8,26H,1-3H3,(H,21,23)(H,27,28,29)(H,30,31,32) |
| InChIKey | LVOZEFDSQCRMIK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 219.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|