C17H12N2O12S3 — CID 23335912
4-[(4-nitro-2-sulfobenzoyl)amino]naphthalene-1,5-disulfonic acid (PubChem CID 23335912) has the molecular formula C17H12N2O12S3 and a molecular weight of 532.49 g/mol. Its IUPAC name is 4-[(4-nitro-2-sulfobenzoyl)amino]naphthalene-1,5-disulfonic acid.
| Compound Name | 4-[(4-nitro-2-sulfobenzoyl)amino]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 23335912 |
| Molecular Formula | C17H12N2O12S3 |
| Molecular Weight | 532.49 g/mol |
| Exact Mass | 531.96 |
| IUPAC Name | 4-[(4-nitro-2-sulfobenzoyl)amino]naphthalene-1,5-disulfonic acid |
| SMILES | O=C(Nc1ccc(S(=O)(=O)O)c2cccc(S(=O)(=O)O)c12)c1ccc([N+](=O)[O-])cc1S(=O)(=O)O |
| InChI | InChI=1S/C17H12N2O12S3/c20-17(11-5-4-9(19(21)22)8-15(11)34(29,30)31)18-12-6-7-13(32(23,24)25)10-2-1-3-14(16(10)12)33(26,27)28/h1-8H,(H,18,20)(H,23,24,25)(H,26,27,28)(H,29,30,31) |
| InChIKey | HIQHABLRMMJYPX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 235.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.49 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|