C23H16N4O14S3 — CID 163992828
4-benzamido-5-hydroxy-6-[(2-hydroxy-5-nitrophenyl)diazenyl]naphthalene-1-sulfonic acid;bis(sulfur trioxide) (PubChem CID 163992828) has the molecular formula C23H16N4O14S3 and a molecular weight of 668.60 g/mol. Its IUPAC name is 4-benzamido-5-hydroxy-6-[(2-hydroxy-5-nitrophenyl)diazenyl]naphthalene-1-sulfonic acid;bis(sulfur trioxide).
| Compound Name | 4-benzamido-5-hydroxy-6-[(2-hydroxy-5-nitrophenyl)diazenyl]naphthalene-1-sulfonic acid;bis(sulfur trioxide) |
|---|---|
| PubChem CID | 163992828 |
| Molecular Formula | C23H16N4O14S3 |
| Molecular Weight | 668.60 g/mol |
| Exact Mass | 667.98 |
| IUPAC Name | 4-benzamido-5-hydroxy-6-[(2-hydroxy-5-nitrophenyl)diazenyl]naphthalene-1-sulfonic acid;bis(sulfur trioxide) |
| SMILES | O=C(Nc1ccc(S(=O)(=O)O)c2ccc(/N=N/c3cc([N+](=O)[O-])ccc3O)c(O)c12)c1ccccc1.O=S(=O)=O.O=S(=O)=O |
| InChI | InChI=1S/C23H16N4O8S.2O3S/c28-19-10-6-14(27(31)32)12-18(19)26-25-17-8-7-15-20(36(33,34)35)11-9-16(21(15)22(17)29)24-23(30)13-4-2-1-3-5-13;2*1-4(2)3/h1-12,28-29H,(H,24,30)(H,33,34,35);;/b26-25+;; |
| InChIKey | UCDJTZBMZVNOCL-LHPVOXLHSA-N |
| XLogP | 3.07 |
| TPSA | 294.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.60 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|