C19H14Br2N4O8S — CID 161151159
6-(2,3-dibromopropanoylamino)-4-hydroxy-3-[(2-hydroxy-5-nitrophenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 161151159) has the molecular formula C19H14Br2N4O8S and a molecular weight of 618.22 g/mol. Its IUPAC name is 6-(2,3-dibromopropanoylamino)-4-hydroxy-3-[(2-hydroxy-5-nitrophenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 6-(2,3-dibromopropanoylamino)-4-hydroxy-3-[(2-hydroxy-5-nitrophenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 161151159 |
| Molecular Formula | C19H14Br2N4O8S |
| Molecular Weight | 618.22 g/mol |
| Exact Mass | 615.89 |
| IUPAC Name | 6-(2,3-dibromopropanoylamino)-4-hydroxy-3-[(2-hydroxy-5-nitrophenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | O=C(Nc1ccc2cc(S(=O)(=O)O)c(/N=N/c3cc([N+](=O)[O-])ccc3O)c(O)c2c1)C(Br)CBr |
| InChI | InChI=1S/C19H14Br2N4O8S/c20-8-13(21)19(28)22-10-2-1-9-5-16(34(31,32)33)17(18(27)12(9)6-10)24-23-14-7-11(25(29)30)3-4-15(14)26/h1-7,13,26-27H,8H2,(H,22,28)(H,31,32,33)/b24-23+ |
| InChIKey | QCJCCINWXLCCDW-WCWDXBQESA-N |
| XLogP | 4.92 |
| TPSA | 191.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.22 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|