C33H24N6O9S2 — CID 177409198
4-hydroxy-6-[(8-hydroxy-7-phenyldiazenyl-6-sulfonaphthalen-2-yl)carbamoylamino]-3-phenyldiazenylnaphthalene-2-sulfonic acid (PubChem CID 177409198) has the molecular formula C33H24N6O9S2 and a molecular weight of 712.72 g/mol. Its IUPAC name is 4-hydroxy-6-[(8-hydroxy-7-phenyldiazenyl-6-sulfonaphthalen-2-yl)carbamoylamino]-3-phenyldiazenylnaphthalene-2-sulfonic acid.
| Compound Name | 4-hydroxy-6-[(8-hydroxy-7-phenyldiazenyl-6-sulfonaphthalen-2-yl)carbamoylamino]-3-phenyldiazenylnaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 177409198 |
| Molecular Formula | C33H24N6O9S2 |
| Molecular Weight | 712.72 g/mol |
| Exact Mass | 712.10 |
| IUPAC Name | 4-hydroxy-6-[(8-hydroxy-7-phenyldiazenyl-6-sulfonaphthalen-2-yl)carbamoylamino]-3-phenyldiazenylnaphthalene-2-sulfonic acid |
| SMILES | O=C(Nc1ccc2cc(S(=O)(=O)O)c(/N=N/c3ccccc3)c(O)c2c1)Nc1ccc2cc(S(=O)(=O)O)c(/N=N/c3ccccc3)c(O)c2c1 |
| InChI | InChI=1S/C33H24N6O9S2/c40-31-25-17-23(13-11-19(25)15-27(49(43,44)45)29(31)38-36-21-7-3-1-4-8-21)34-33(42)35-24-14-12-20-16-28(50(46,47)48)30(32(41)26(20)18-24)39-37-22-9-5-2-6-10-22/h1-18,40-41H,(H2,34,35,42)(H,43,44,45)(H,46,47,48)/b38-36+,39-37+ |
| InChIKey | QKHFYRMAXLOSHJ-NFSGFYSESA-N |
| XLogP | 8.37 |
| TPSA | 239.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.72 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|