C30H23N5O7S — CID 136714766
2-hydroxy-5-[[4-[4-[[1-hydroxy-7-(methylamino)-3-sulfonaphthalen-2-yl]diazenyl]phenyl]phenyl]diazenyl]benzoic acid (PubChem CID 136714766) has the molecular formula C30H23N5O7S and a molecular weight of 597.61 g/mol. Its IUPAC name is 2-hydroxy-5-[[4-[4-[[1-hydroxy-7-(methylamino)-3-sulfonaphthalen-2-yl]diazenyl]phenyl]phenyl]diazenyl]benzoic acid.
| Compound Name | 2-hydroxy-5-[[4-[4-[[1-hydroxy-7-(methylamino)-3-sulfonaphthalen-2-yl]diazenyl]phenyl]phenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 136714766 |
| Molecular Formula | C30H23N5O7S |
| Molecular Weight | 597.61 g/mol |
| Exact Mass | 597.13 |
| IUPAC Name | 2-hydroxy-5-[[4-[4-[[1-hydroxy-7-(methylamino)-3-sulfonaphthalen-2-yl]diazenyl]phenyl]phenyl]diazenyl]benzoic acid |
| SMILES | CNc1ccc2cc(S(=O)(=O)O)c(/N=N/c3ccc(-c4ccc(/N=N/c5ccc(O)c(C(=O)O)c5)cc4)cc3)c(O)c2c1 |
| InChI | InChI=1S/C30H23N5O7S/c1-31-22-11-6-19-14-27(43(40,41)42)28(29(37)24(19)15-22)35-33-21-9-4-18(5-10-21)17-2-7-20(8-3-17)32-34-23-12-13-26(36)25(16-23)30(38)39/h2-16,31,36-37H,1H3,(H,38,39)(H,40,41,42)/b34-32+,35-33+ |
| InChIKey | IVDRSHLPADOSRL-XUXOKTBYSA-N |
| XLogP | 7.74 |
| TPSA | 193.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.61 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|