C31H25N5Na2O7S — CID 137241911
CID 137241911 (PubChem CID 137241911) has the molecular formula C31H25N5Na2O7S and a molecular weight of 657.62 g/mol.
| Compound Name | CID 137241911 |
|---|---|
| PubChem CID | 137241911 |
| Molecular Formula | C31H25N5Na2O7S |
| Molecular Weight | 657.62 g/mol |
| Exact Mass | 657.13 |
| IUPAC Name | — |
| SMILES | CN(C)c1ccc2cc(S(=O)(=O)O)c(/N=N/c3ccc(-c4ccc(/N=N/c5ccc(O)c(C(=O)O)c5)cc4)cc3)c(O)c2c1.[Na].[Na] |
| InChI | InChI=1S/C31H25N5O7S.2Na/c1-36(2)24-13-7-20-15-28(44(41,42)43)29(30(38)25(20)17-24)35-33-22-10-5-19(6-11-22)18-3-8-21(9-4-18)32-34-23-12-14-27(37)26(16-23)31(39)40;;/h3-17,37-38H,1-2H3,(H,39,40)(H,41,42,43);;/b34-32+,35-33+;; |
| InChIKey | SXCBZVSYSOCTNO-DCQXEBMNSA-N |
| XLogP | 7.00 |
| TPSA | 184.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.62 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|