C33H23N7O10S2 — CID 137492459
5-[[4-[[4-[(6-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-6-sulfonaphthalen-1-yl]diazenyl]phenyl]diazenyl]-2-hydroxybenzoic acid (PubChem CID 137492459) has the molecular formula C33H23N7O10S2 and a molecular weight of 741.72 g/mol. Its IUPAC name is 5-[[4-[[4-[(6-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-6-sulfonaphthalen-1-yl]diazenyl]phenyl]diazenyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-[[4-[(6-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-6-sulfonaphthalen-1-yl]diazenyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 137492459 |
| Molecular Formula | C33H23N7O10S2 |
| Molecular Weight | 741.72 g/mol |
| Exact Mass | 741.09 |
| IUPAC Name | 5-[[4-[[4-[(6-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-6-sulfonaphthalen-1-yl]diazenyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
| SMILES | Nc1ccc2c(O)c(/N=N/c3ccc(/N=N/c4ccc(/N=N/c5ccc(O)c(C(=O)O)c5)cc4)c4ccc(S(=O)(=O)O)cc34)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C33H23N7O10S2/c34-18-1-8-23-17(13-18)14-30(52(48,49)50)31(32(23)42)40-39-28-11-10-27(24-9-7-22(16-25(24)28)51(45,46)47)38-36-20-4-2-19(3-5-20)35-37-21-6-12-29(41)26(15-21)33(43)44/h1-16,41-42H,34H2,(H,43,44)(H,45,46,47)(H,48,49,50)/b37-35+,38-36+,40-39+ |
| InChIKey | RMAIHIYJRXYJHN-MPJKNSADSA-N |
| XLogP | 8.42 |
| TPSA | 286.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.72 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|