C35H26N8O6S — CID 165362994
5-[[4-[4-[[4-[(2,4-diaminophenyl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid (PubChem CID 165362994) has the molecular formula C35H26N8O6S and a molecular weight of 686.71 g/mol. Its IUPAC name is 5-[[4-[4-[[4-[(2,4-diaminophenyl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-[4-[[4-[(2,4-diaminophenyl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 165362994 |
| Molecular Formula | C35H26N8O6S |
| Molecular Weight | 686.71 g/mol |
| Exact Mass | 686.17 |
| IUPAC Name | 5-[[4-[4-[[4-[(2,4-diaminophenyl)diazenyl]-7-sulfonaphthalen-1-yl]diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
| SMILES | Nc1ccc(/N=N/c2ccc(/N=N/c3ccc(-c4ccc(/N=N/c5ccc(O)c(C(=O)O)c5)cc4)cc3)c3cc(S(=O)(=O)O)ccc23)c(N)c1 |
| InChI | InChI=1S/C35H26N8O6S/c36-22-5-13-33(30(37)17-22)43-42-31-14-15-32(28-19-26(50(47,48)49)11-12-27(28)31)41-39-24-8-3-21(4-9-24)20-1-6-23(7-2-20)38-40-25-10-16-34(44)29(18-25)35(45)46/h1-19,44H,36-37H2,(H,45,46)(H,47,48,49)/b40-38+,41-39+,43-42+ |
| InChIKey | SOMQFVFJWOSECU-YZUCYXIHSA-N |
| XLogP | 9.57 |
| TPSA | 238.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.71 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|