C38H30N8NaO6S+ — CID 135534396
sodium 5-[[4-[4-[[2,4-diamino-5-methyl-3-[[4-(4-sulfophenyl)phenyl]diazenyl]phenyl]diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid (PubChem CID 135534396) has the molecular formula C38H30N8NaO6S+ and a molecular weight of 749.77 g/mol. Its IUPAC name is sodium 5-[[4-[4-[[2,4-diamino-5-methyl-3-[[4-(4-sulfophenyl)phenyl]diazenyl]phenyl]diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid.
| Compound Name | sodium 5-[[4-[4-[[2,4-diamino-5-methyl-3-[[4-(4-sulfophenyl)phenyl]diazenyl]phenyl]diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 135534396 |
| Molecular Formula | C38H30N8NaO6S+ |
| Molecular Weight | 749.77 g/mol |
| Exact Mass | 749.19 |
| IUPAC Name | sodium 5-[[4-[4-[[2,4-diamino-5-methyl-3-[[4-(4-sulfophenyl)phenyl]diazenyl]phenyl]diazenyl]phenyl]phenyl]diazenyl]-2-hydroxybenzoic acid |
| SMILES | Cc1cc(/N=N/c2ccc(-c3ccc(/N=N/c4ccc(O)c(C(=O)O)c4)cc3)cc2)c(N)c(/N=N/c2ccc(-c3ccc(S(=O)(=O)O)cc3)cc2)c1N.[Na+] |
| InChI | InChI=1S/C38H30N8O6S.Na/c1-22-20-33(36(40)37(35(22)39)46-43-29-14-6-25(7-15-29)26-8-17-31(18-9-26)53(50,51)52)45-42-28-12-4-24(5-13-28)23-2-10-27(11-3-23)41-44-30-16-19-34(47)32(21-30)38(48)49;/h2-21,47H,39-40H2,1H3,(H,48,49)(H,50,51,52);/q;+1/b44-41+,45-42+,46-43+; |
| InChIKey | WWTANYLRLIIIRR-KCFZBVGPSA-N |
| XLogP | 7.39 |
| TPSA | 238.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.77 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|