C28H24N6Na2O6S — CID 135499571
disodium;2,4-diamino-3-[[4-[4-[(3-carboxy-4-oxidophenyl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]-5-methylbenzenesulfonate (PubChem CID 135499571) has the molecular formula C28H24N6Na2O6S and a molecular weight of 618.58 g/mol. Its IUPAC name is disodium;2,4-diamino-3-[[4-[4-[(3-carboxy-4-oxidophenyl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]-5-methylbenzenesulfonate.
| Compound Name | disodium;2,4-diamino-3-[[4-[4-[(3-carboxy-4-oxidophenyl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]-5-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135499571 |
| Molecular Formula | C28H24N6Na2O6S |
| Molecular Weight | 618.58 g/mol |
| Exact Mass | 618.13 |
| IUPAC Name | disodium;2,4-diamino-3-[[4-[4-[(3-carboxy-4-oxidophenyl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]-5-methylbenzenesulfonate |
| SMILES | Cc1cc(-c2ccc(/N=N/c3c(N)c(C)cc(S(=O)(=O)[O-])c3N)c(C)c2)ccc1/N=N/c1ccc([O-])c(C(=O)O)c1.[Na+].[Na+] |
| InChI | InChI=1S/C28H26N6O6S.2Na/c1-14-10-17(4-7-21(14)32-31-19-6-9-23(35)20(13-19)28(36)37)18-5-8-22(15(2)11-18)33-34-27-25(29)16(3)12-24(26(27)30)41(38,39)40;;/h4-13,35H,29-30H2,1-3H3,(H,36,37)(H,38,39,40);;/q;2*+1/p-2/b32-31+,34-33+;; |
| InChIKey | VHGDEGWDHMWQLR-DUCFOALUSA-L |
| XLogP | -0.04 |
| TPSA | 219.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.58 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|