C27H22N6Na2O6S — CID 135666459
disodium;2,4-diamino-5-[[4-[4-[(3-carboxy-4-oxidophenyl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]benzenesulfonate (PubChem CID 135666459) has the molecular formula C27H22N6Na2O6S and a molecular weight of 604.56 g/mol. Its IUPAC name is disodium;2,4-diamino-5-[[4-[4-[(3-carboxy-4-oxidophenyl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]benzenesulfonate.
| Compound Name | disodium;2,4-diamino-5-[[4-[4-[(3-carboxy-4-oxidophenyl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 135666459 |
| Molecular Formula | C27H22N6Na2O6S |
| Molecular Weight | 604.56 g/mol |
| Exact Mass | 604.11 |
| IUPAC Name | disodium;2,4-diamino-5-[[4-[4-[(3-carboxy-4-oxidophenyl)diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]benzenesulfonate |
| SMILES | Cc1cc(-c2ccc(/N=N/c3cc(S(=O)(=O)[O-])c(N)cc3N)c(C)c2)ccc1/N=N/c1ccc([O-])c(C(=O)O)c1.[Na+].[Na+] |
| InChI | InChI=1S/C27H24N6O6S.2Na/c1-14-9-16(3-6-22(14)31-30-18-5-8-25(34)19(11-18)27(35)36)17-4-7-23(15(2)10-17)32-33-24-13-26(40(37,38)39)21(29)12-20(24)28;;/h3-13,34H,28-29H2,1-2H3,(H,35,36)(H,37,38,39);;/q;2*+1/p-2/b31-30+,33-32+;; |
| InChIKey | QPZWGYNLLYWYRP-MYYXEQMMSA-L |
| XLogP | -0.35 |
| TPSA | 219.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.56 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|