C35H25N8Na2O6S+ — CID 165362993
disodium;8-[[4-[4-[(3-carboxy-4-hydroxyphenyl)diazenyl]phenyl]phenyl]diazenyl]-5-[(2,4-diaminophenyl)diazenyl]naphthalene-2-sulfonate (PubChem CID 165362993) has the molecular formula C35H25N8Na2O6S+ and a molecular weight of 731.68 g/mol. Its IUPAC name is disodium;8-[[4-[4-[(3-carboxy-4-hydroxyphenyl)diazenyl]phenyl]phenyl]diazenyl]-5-[(2,4-diaminophenyl)diazenyl]naphthalene-2-sulfonate.
| Compound Name | disodium;8-[[4-[4-[(3-carboxy-4-hydroxyphenyl)diazenyl]phenyl]phenyl]diazenyl]-5-[(2,4-diaminophenyl)diazenyl]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 165362993 |
| Molecular Formula | C35H25N8Na2O6S+ |
| Molecular Weight | 731.68 g/mol |
| Exact Mass | 731.14 |
| IUPAC Name | disodium;8-[[4-[4-[(3-carboxy-4-hydroxyphenyl)diazenyl]phenyl]phenyl]diazenyl]-5-[(2,4-diaminophenyl)diazenyl]naphthalene-2-sulfonate |
| SMILES | Nc1ccc(/N=N/c2ccc(/N=N/c3ccc(-c4ccc(/N=N/c5ccc(O)c(C(=O)O)c5)cc4)cc3)c3cc(S(=O)(=O)[O-])ccc23)c(N)c1.[Na+].[Na+] |
| InChI | InChI=1S/C35H26N8O6S.2Na/c36-22-5-13-33(30(37)17-22)43-42-31-14-15-32(28-19-26(50(47,48)49)11-12-27(28)31)41-39-24-8-3-21(4-9-24)20-1-6-23(7-2-20)38-40-25-10-16-34(44)29(18-25)35(45)46;;/h1-19,44H,36-37H2,(H,45,46)(H,47,48,49);;/q;2*+1/p-1/b40-38+,41-39+,43-42+;; |
| InChIKey | ZSBRZLNVLUKLRO-LEWUHBCRSA-M |
| XLogP | 3.23 |
| TPSA | 240.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.68 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|