C22H16N3NaO4S — CID 135488966
sodium 8-amino-5-[[4-(4-hydroxyphenyl)phenyl]diazenyl]naphthalene-2-sulfonate (PubChem CID 135488966) has the molecular formula C22H16N3NaO4S and a molecular weight of 441.44 g/mol. Its IUPAC name is sodium 8-amino-5-[[4-(4-hydroxyphenyl)phenyl]diazenyl]naphthalene-2-sulfonate.
| Compound Name | sodium 8-amino-5-[[4-(4-hydroxyphenyl)phenyl]diazenyl]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 135488966 |
| Molecular Formula | C22H16N3NaO4S |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | sodium 8-amino-5-[[4-(4-hydroxyphenyl)phenyl]diazenyl]naphthalene-2-sulfonate |
| SMILES | Nc1ccc(/N=N/c2ccc(-c3ccc(O)cc3)cc2)c2ccc(S(=O)(=O)[O-])cc12.[Na+] |
| InChI | InChI=1S/C22H17N3O4S.Na/c23-21-11-12-22(19-10-9-18(13-20(19)21)30(27,28)29)25-24-16-5-1-14(2-6-16)15-3-7-17(26)8-4-15;/h1-13,26H,23H2,(H,27,28,29);/q;+1/p-1/b25-24+; |
| InChIKey | IKGWSKUMUVVHGJ-QREUMGABSA-M |
| XLogP | 2.12 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|