C23H16Li2N4O6S2 — CID 59248222
dilithium;5-[(4-methylphenyl)diazenyl]-8-[(4-sulfonatophenyl)diazenyl]naphthalene-2-sulfonate (PubChem CID 59248222) has the molecular formula C23H16Li2N4O6S2 and a molecular weight of 522.42 g/mol. Its IUPAC name is dilithium;5-[(4-methylphenyl)diazenyl]-8-[(4-sulfonatophenyl)diazenyl]naphthalene-2-sulfonate.
| Compound Name | dilithium;5-[(4-methylphenyl)diazenyl]-8-[(4-sulfonatophenyl)diazenyl]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 59248222 |
| Molecular Formula | C23H16Li2N4O6S2 |
| Molecular Weight | 522.42 g/mol |
| Exact Mass | 522.08 |
| IUPAC Name | dilithium;5-[(4-methylphenyl)diazenyl]-8-[(4-sulfonatophenyl)diazenyl]naphthalene-2-sulfonate |
| SMILES | Cc1ccc(/N=N/c2ccc(/N=N/c3ccc(S(=O)(=O)[O-])cc3)c3cc(S(=O)(=O)[O-])ccc23)cc1.[Li+].[Li+] |
| InChI | InChI=1S/C23H18N4O6S2.2Li/c1-15-2-4-16(5-3-15)24-26-22-12-13-23(21-14-19(35(31,32)33)10-11-20(21)22)27-25-17-6-8-18(9-7-17)34(28,29)30;;/h2-14H,1H3,(H,28,29,30)(H,31,32,33);;/q;2*+1/p-2/b26-24+,27-25+;; |
| InChIKey | QBDUKAYSHZOIEW-SRJQXOPESA-L |
| XLogP | -0.20 |
| TPSA | 163.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.42 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|